C19H17N3O5S — CID 7483167
2-(1,3-dioxoisoindol-2-yl)-N-[3-(1,1-dioxo-1,2-thiazolidin-2-yl)phenyl]acetamide (PubChem CID 7483167) has the molecular formula C19H17N3O5S and a molecular weight of 399.43 g/mol. Its IUPAC name is 2-(1,3-dioxoisoindol-2-yl)-N-[3-(1,1-dioxo-1,2-thiazolidin-2-yl)phenyl]acetamide.
| Compound Name | 2-(1,3-dioxoisoindol-2-yl)-N-[3-(1,1-dioxo-1,2-thiazolidin-2-yl)phenyl]acetamide |
|---|---|
| PubChem CID | 7483167 |
| Molecular Formula | C19H17N3O5S |
| Molecular Weight | 399.43 g/mol |
| Exact Mass | 399.09 |
| IUPAC Name | 2-(1,3-dioxoisoindol-2-yl)-N-[3-(1,1-dioxo-1,2-thiazolidin-2-yl)phenyl]acetamide |
| SMILES | O=C(CN1C(=O)c2ccccc2C1=O)Nc1cccc(N2CCCS2(=O)=O)c1 |
| InChI | InChI=1S/C19H17N3O5S/c23-17(12-21-18(24)15-7-1-2-8-16(15)19(21)25)20-13-5-3-6-14(11-13)22-9-4-10-28(22,26)27/h1-3,5-8,11H,4,9-10,12H2,(H,20,23) |
| InChIKey | ZYSFANJGSKMQMA-UHFFFAOYSA-N |
| XLogP | 1.46 |
| TPSA | 103.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.43 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|