C20H19N3O5S — CID 55934242
N-[5-(1,1-dioxo-1,2-thiazolidin-2-yl)-2-hydroxyphenyl]-2-(1-methylidene-3-oxoisoindol-2-yl)acetamide (PubChem CID 55934242) has the molecular formula C20H19N3O5S and a molecular weight of 413.46 g/mol. Its IUPAC name is N-[5-(1,1-dioxo-1,2-thiazolidin-2-yl)-2-hydroxyphenyl]-2-(1-methylidene-3-oxoisoindol-2-yl)acetamide.
| Compound Name | N-[5-(1,1-dioxo-1,2-thiazolidin-2-yl)-2-hydroxyphenyl]-2-(1-methylidene-3-oxoisoindol-2-yl)acetamide |
|---|---|
| PubChem CID | 55934242 |
| Molecular Formula | C20H19N3O5S |
| Molecular Weight | 413.46 g/mol |
| Exact Mass | 413.10 |
| IUPAC Name | N-[5-(1,1-dioxo-1,2-thiazolidin-2-yl)-2-hydroxyphenyl]-2-(1-methylidene-3-oxoisoindol-2-yl)acetamide |
| SMILES | C=C1c2ccccc2C(=O)N1CC(=O)Nc1cc(N2CCCS2(=O)=O)ccc1O |
| InChI | InChI=1S/C20H19N3O5S/c1-13-15-5-2-3-6-16(15)20(26)22(13)12-19(25)21-17-11-14(7-8-18(17)24)23-9-4-10-29(23,27)28/h2-3,5-8,11,24H,1,4,9-10,12H2,(H,21,25) |
| InChIKey | WOKJGSSCNABQMV-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 107.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.46 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|