C16H14Cl2N2O4S — CID 55815013
2,3-dichloro-N-[5-(1,1-dioxo-1,2-thiazolidin-2-yl)-2-hydroxyphenyl]benzamide (PubChem CID 55815013) has the molecular formula C16H14Cl2N2O4S and a molecular weight of 401.27 g/mol. Its IUPAC name is 2,3-dichloro-N-[5-(1,1-dioxo-1,2-thiazolidin-2-yl)-2-hydroxyphenyl]benzamide.
| Compound Name | 2,3-dichloro-N-[5-(1,1-dioxo-1,2-thiazolidin-2-yl)-2-hydroxyphenyl]benzamide |
|---|---|
| PubChem CID | 55815013 |
| Molecular Formula | C16H14Cl2N2O4S |
| Molecular Weight | 401.27 g/mol |
| Exact Mass | 400.01 |
| IUPAC Name | 2,3-dichloro-N-[5-(1,1-dioxo-1,2-thiazolidin-2-yl)-2-hydroxyphenyl]benzamide |
| SMILES | O=C(Nc1cc(N2CCCS2(=O)=O)ccc1O)c1cccc(Cl)c1Cl |
| InChI | InChI=1S/C16H14Cl2N2O4S/c17-12-4-1-3-11(15(12)18)16(22)19-13-9-10(5-6-14(13)21)20-7-2-8-25(20,23)24/h1,3-6,9,21H,2,7-8H2,(H,19,22) |
| InChIKey | UMBZSLPVSPMBEM-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 86.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.27 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|