C20H20ClN3O5S — CID 55815204
1-(3-chlorophenyl)-N-[5-(1,1-dioxo-1,2-thiazolidin-2-yl)-2-hydroxyphenyl]-5-oxopyrrolidine-3-carboxamide (PubChem CID 55815204) has the molecular formula C20H20ClN3O5S and a molecular weight of 449.92 g/mol. Its IUPAC name is 1-(3-chlorophenyl)-N-[5-(1,1-dioxo-1,2-thiazolidin-2-yl)-2-hydroxyphenyl]-5-oxopyrrolidine-3-carboxamide.
| Compound Name | 1-(3-chlorophenyl)-N-[5-(1,1-dioxo-1,2-thiazolidin-2-yl)-2-hydroxyphenyl]-5-oxopyrrolidine-3-carboxamide |
|---|---|
| PubChem CID | 55815204 |
| Molecular Formula | C20H20ClN3O5S |
| Molecular Weight | 449.92 g/mol |
| Exact Mass | 449.08 |
| IUPAC Name | 1-(3-chlorophenyl)-N-[5-(1,1-dioxo-1,2-thiazolidin-2-yl)-2-hydroxyphenyl]-5-oxopyrrolidine-3-carboxamide |
| SMILES | O=C(Nc1cc(N2CCCS2(=O)=O)ccc1O)C1CC(=O)N(c2cccc(Cl)c2)C1 |
| InChI | InChI=1S/C20H20ClN3O5S/c21-14-3-1-4-15(10-14)23-12-13(9-19(23)26)20(27)22-17-11-16(5-6-18(17)25)24-7-2-8-30(24,28)29/h1,3-6,10-11,13,25H,2,7-9,12H2,(H,22,27) |
| InChIKey | RYTPBSCFTCLOAR-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 107.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.92 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|