C19H16ClN3O4S2 — CID 167841494
2-(3-chlorophenyl)-N-[5-(1,1-dioxo-1,2-thiazolidin-2-yl)-2-hydroxyphenyl]-1,3-thiazole-4-carboxamide (PubChem CID 167841494) has the molecular formula C19H16ClN3O4S2 and a molecular weight of 449.94 g/mol. Its IUPAC name is 2-(3-chlorophenyl)-N-[5-(1,1-dioxo-1,2-thiazolidin-2-yl)-2-hydroxyphenyl]-1,3-thiazole-4-carboxamide.
| Compound Name | 2-(3-chlorophenyl)-N-[5-(1,1-dioxo-1,2-thiazolidin-2-yl)-2-hydroxyphenyl]-1,3-thiazole-4-carboxamide |
|---|---|
| PubChem CID | 167841494 |
| Molecular Formula | C19H16ClN3O4S2 |
| Molecular Weight | 449.94 g/mol |
| Exact Mass | 449.03 |
| IUPAC Name | 2-(3-chlorophenyl)-N-[5-(1,1-dioxo-1,2-thiazolidin-2-yl)-2-hydroxyphenyl]-1,3-thiazole-4-carboxamide |
| SMILES | O=C(Nc1cc(N2CCCS2(=O)=O)ccc1O)c1csc(-c2cccc(Cl)c2)n1 |
| InChI | InChI=1S/C19H16ClN3O4S2/c20-13-4-1-3-12(9-13)19-22-16(11-28-19)18(25)21-15-10-14(5-6-17(15)24)23-7-2-8-29(23,26)27/h1,3-6,9-11,24H,2,7-8H2,(H,21,25) |
| InChIKey | RWGKPZRMXLASIA-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 99.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.94 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|