C18H20N2O5S — CID 55815169
N-[5-(1,1-dioxo-1,2-thiazolidin-2-yl)-2-hydroxyphenyl]-3-methoxy-4-methylbenzamide (PubChem CID 55815169) has the molecular formula C18H20N2O5S and a molecular weight of 376.43 g/mol. Its IUPAC name is N-[5-(1,1-dioxo-1,2-thiazolidin-2-yl)-2-hydroxyphenyl]-3-methoxy-4-methylbenzamide.
| Compound Name | N-[5-(1,1-dioxo-1,2-thiazolidin-2-yl)-2-hydroxyphenyl]-3-methoxy-4-methylbenzamide |
|---|---|
| PubChem CID | 55815169 |
| Molecular Formula | C18H20N2O5S |
| Molecular Weight | 376.43 g/mol |
| Exact Mass | 376.11 |
| IUPAC Name | N-[5-(1,1-dioxo-1,2-thiazolidin-2-yl)-2-hydroxyphenyl]-3-methoxy-4-methylbenzamide |
| SMILES | COc1cc(C(=O)Nc2cc(N3CCCS3(=O)=O)ccc2O)ccc1C |
| InChI | InChI=1S/C18H20N2O5S/c1-12-4-5-13(10-17(12)25-2)18(22)19-15-11-14(6-7-16(15)21)20-8-3-9-26(20,23)24/h4-7,10-11,21H,3,8-9H2,1-2H3,(H,19,22) |
| InChIKey | PZSGRYVFBVXNSL-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 95.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.43 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|