C18H19N3O6S — CID 7482937
N-[4-(1,1-dioxo-1,2-thiazolidin-2-yl)-2-methoxyphenyl]-4-methyl-3-nitrobenzamide (PubChem CID 7482937) has the molecular formula C18H19N3O6S and a molecular weight of 405.43 g/mol. Its IUPAC name is N-[4-(1,1-dioxo-1,2-thiazolidin-2-yl)-2-methoxyphenyl]-4-methyl-3-nitrobenzamide.
| Compound Name | N-[4-(1,1-dioxo-1,2-thiazolidin-2-yl)-2-methoxyphenyl]-4-methyl-3-nitrobenzamide |
|---|---|
| PubChem CID | 7482937 |
| Molecular Formula | C18H19N3O6S |
| Molecular Weight | 405.43 g/mol |
| Exact Mass | 405.10 |
| IUPAC Name | N-[4-(1,1-dioxo-1,2-thiazolidin-2-yl)-2-methoxyphenyl]-4-methyl-3-nitrobenzamide |
| SMILES | COc1cc(N2CCCS2(=O)=O)ccc1NC(=O)c1ccc(C)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C18H19N3O6S/c1-12-4-5-13(10-16(12)21(23)24)18(22)19-15-7-6-14(11-17(15)27-2)20-8-3-9-28(20,25)26/h4-7,10-11H,3,8-9H2,1-2H3,(H,19,22) |
| InChIKey | NAHBRSZWSRMIRB-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 118.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.43 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|