C20H23N3O5S — CID 44901585
N'-[5-(1,1-dioxo-1,2-thiazolidin-2-yl)-2-methylphenyl]-N-(2-methoxy-5-methylphenyl)oxamide (PubChem CID 44901585) has the molecular formula C20H23N3O5S and a molecular weight of 417.49 g/mol. Its IUPAC name is N'-[5-(1,1-dioxo-1,2-thiazolidin-2-yl)-2-methylphenyl]-N-(2-methoxy-5-methylphenyl)oxamide.
| Compound Name | N'-[5-(1,1-dioxo-1,2-thiazolidin-2-yl)-2-methylphenyl]-N-(2-methoxy-5-methylphenyl)oxamide |
|---|---|
| PubChem CID | 44901585 |
| Molecular Formula | C20H23N3O5S |
| Molecular Weight | 417.49 g/mol |
| Exact Mass | 417.14 |
| IUPAC Name | N'-[5-(1,1-dioxo-1,2-thiazolidin-2-yl)-2-methylphenyl]-N-(2-methoxy-5-methylphenyl)oxamide |
| SMILES | COc1ccc(C)cc1NC(=O)C(=O)Nc1cc(N2CCCS2(=O)=O)ccc1C |
| InChI | InChI=1S/C20H23N3O5S/c1-13-5-8-18(28-3)17(11-13)22-20(25)19(24)21-16-12-15(7-6-14(16)2)23-9-4-10-29(23,26)27/h5-8,11-12H,4,9-10H2,1-3H3,(H,21,24)(H,22,25) |
| InChIKey | UFZVWEFEEKBBSM-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 104.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.49 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|