C18H26N4O6S — CID 29138842
N'-[5-(1,1-dioxo-1,2-thiazolidin-2-yl)-2-methoxyphenyl]-N-(2-morpholin-4-ylethyl)oxamide (PubChem CID 29138842) has the molecular formula C18H26N4O6S and a molecular weight of 426.50 g/mol. Its IUPAC name is N'-[5-(1,1-dioxo-1,2-thiazolidin-2-yl)-2-methoxyphenyl]-N-(2-morpholin-4-ylethyl)oxamide.
| Compound Name | N'-[5-(1,1-dioxo-1,2-thiazolidin-2-yl)-2-methoxyphenyl]-N-(2-morpholin-4-ylethyl)oxamide |
|---|---|
| PubChem CID | 29138842 |
| Molecular Formula | C18H26N4O6S |
| Molecular Weight | 426.50 g/mol |
| Exact Mass | 426.16 |
| IUPAC Name | N'-[5-(1,1-dioxo-1,2-thiazolidin-2-yl)-2-methoxyphenyl]-N-(2-morpholin-4-ylethyl)oxamide |
| SMILES | COc1ccc(N2CCCS2(=O)=O)cc1NC(=O)C(=O)NCCN1CCOCC1 |
| InChI | InChI=1S/C18H26N4O6S/c1-27-16-4-3-14(22-6-2-12-29(22,25)26)13-15(16)20-18(24)17(23)19-5-7-21-8-10-28-11-9-21/h3-4,13H,2,5-12H2,1H3,(H,19,23)(H,20,24) |
| InChIKey | VQQFWTVUVNOIIM-UHFFFAOYSA-N |
| XLogP | -0.38 |
| TPSA | 117.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.50 |
| LogP ≤ 5 | -0.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|