C22H27N3O5 — CID 16891638
N'-(2,5-dimethoxyphenyl)-N-[2-(4-morpholin-4-ylphenyl)ethyl]oxamide (PubChem CID 16891638) has the molecular formula C22H27N3O5 and a molecular weight of 413.47 g/mol. Its IUPAC name is N'-(2,5-dimethoxyphenyl)-N-[2-(4-morpholin-4-ylphenyl)ethyl]oxamide.
| Compound Name | N'-(2,5-dimethoxyphenyl)-N-[2-(4-morpholin-4-ylphenyl)ethyl]oxamide |
|---|---|
| PubChem CID | 16891638 |
| Molecular Formula | C22H27N3O5 |
| Molecular Weight | 413.47 g/mol |
| Exact Mass | 413.20 |
| IUPAC Name | N'-(2,5-dimethoxyphenyl)-N-[2-(4-morpholin-4-ylphenyl)ethyl]oxamide |
| SMILES | COc1ccc(OC)c(NC(=O)C(=O)NCCc2ccc(N3CCOCC3)cc2)c1 |
| InChI | InChI=1S/C22H27N3O5/c1-28-18-7-8-20(29-2)19(15-18)24-22(27)21(26)23-10-9-16-3-5-17(6-4-16)25-11-13-30-14-12-25/h3-8,15H,9-14H2,1-2H3,(H,23,26)(H,24,27) |
| InChIKey | HGAWGNNWTSNENF-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 89.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.47 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|