C16H22N4O6 — CID 108518532
N'-(2-methoxy-5-nitrophenyl)-N-(3-morpholin-4-ylpropyl)oxamide (PubChem CID 108518532) has the molecular formula C16H22N4O6 and a molecular weight of 366.37 g/mol. Its IUPAC name is N'-(2-methoxy-5-nitrophenyl)-N-(3-morpholin-4-ylpropyl)oxamide.
| Compound Name | N'-(2-methoxy-5-nitrophenyl)-N-(3-morpholin-4-ylpropyl)oxamide |
|---|---|
| PubChem CID | 108518532 |
| Molecular Formula | C16H22N4O6 |
| Molecular Weight | 366.37 g/mol |
| Exact Mass | 366.15 |
| IUPAC Name | N'-(2-methoxy-5-nitrophenyl)-N-(3-morpholin-4-ylpropyl)oxamide |
| SMILES | COc1ccc([N+](=O)[O-])cc1NC(=O)C(=O)NCCCN1CCOCC1 |
| InChI | InChI=1S/C16H22N4O6/c1-25-14-4-3-12(20(23)24)11-13(14)18-16(22)15(21)17-5-2-6-19-7-9-26-10-8-19/h3-4,11H,2,5-10H2,1H3,(H,17,21)(H,18,22) |
| InChIKey | IPULCTNTASACJI-UHFFFAOYSA-N |
| XLogP | 0.38 |
| TPSA | 123.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.37 |
| LogP ≤ 5 | 0.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|