C14H18N4O6 — CID 3111269
N-(3-morpholin-4-ylpropyl)-2,4-dinitrobenzamide (PubChem CID 3111269) has the molecular formula C14H18N4O6 and a molecular weight of 338.32 g/mol. Its IUPAC name is N-(3-morpholin-4-ylpropyl)-2,4-dinitrobenzamide.
| Compound Name | N-(3-morpholin-4-ylpropyl)-2,4-dinitrobenzamide |
|---|---|
| PubChem CID | 3111269 |
| Molecular Formula | C14H18N4O6 |
| Molecular Weight | 338.32 g/mol |
| Exact Mass | 338.12 |
| IUPAC Name | N-(3-morpholin-4-ylpropyl)-2,4-dinitrobenzamide |
| SMILES | O=C(NCCCN1CCOCC1)c1ccc([N+](=O)[O-])cc1[N+](=O)[O-] |
| InChI | InChI=1S/C14H18N4O6/c19-14(15-4-1-5-16-6-8-24-9-7-16)12-3-2-11(17(20)21)10-13(12)18(22)23/h2-3,10H,1,4-9H2,(H,15,19) |
| InChIKey | SDZVYGFKAVRKEX-UHFFFAOYSA-N |
| XLogP | 0.96 |
| TPSA | 127.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.32 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|