C21H32N4O4 — CID 55782073
N-[3-(3,5-dimethylpiperidin-1-yl)propyl]-2-morpholin-4-yl-5-nitrobenzamide (PubChem CID 55782073) has the molecular formula C21H32N4O4 and a molecular weight of 404.51 g/mol. Its IUPAC name is N-[3-(3,5-dimethylpiperidin-1-yl)propyl]-2-morpholin-4-yl-5-nitrobenzamide.
| Compound Name | N-[3-(3,5-dimethylpiperidin-1-yl)propyl]-2-morpholin-4-yl-5-nitrobenzamide |
|---|---|
| PubChem CID | 55782073 |
| Molecular Formula | C21H32N4O4 |
| Molecular Weight | 404.51 g/mol |
| Exact Mass | 404.24 |
| IUPAC Name | N-[3-(3,5-dimethylpiperidin-1-yl)propyl]-2-morpholin-4-yl-5-nitrobenzamide |
| SMILES | CC1CC(C)CN(CCCNC(=O)c2cc([N+](=O)[O-])ccc2N2CCOCC2)C1 |
| InChI | InChI=1S/C21H32N4O4/c1-16-12-17(2)15-23(14-16)7-3-6-22-21(26)19-13-18(25(27)28)4-5-20(19)24-8-10-29-11-9-24/h4-5,13,16-17H,3,6-12,14-15H2,1-2H3,(H,22,26) |
| InChIKey | VIGSPJLOXWFBHS-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 87.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.51 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|