C20H23N3O6 — CID 55595517
N-[(3,5-dimethoxyphenyl)methyl]-2-morpholin-4-yl-5-nitrobenzamide (PubChem CID 55595517) has the molecular formula C20H23N3O6 and a molecular weight of 401.42 g/mol. Its IUPAC name is N-[(3,5-dimethoxyphenyl)methyl]-2-morpholin-4-yl-5-nitrobenzamide.
| Compound Name | N-[(3,5-dimethoxyphenyl)methyl]-2-morpholin-4-yl-5-nitrobenzamide |
|---|---|
| PubChem CID | 55595517 |
| Molecular Formula | C20H23N3O6 |
| Molecular Weight | 401.42 g/mol |
| Exact Mass | 401.16 |
| IUPAC Name | N-[(3,5-dimethoxyphenyl)methyl]-2-morpholin-4-yl-5-nitrobenzamide |
| SMILES | COc1cc(CNC(=O)c2cc([N+](=O)[O-])ccc2N2CCOCC2)cc(OC)c1 |
| InChI | InChI=1S/C20H23N3O6/c1-27-16-9-14(10-17(12-16)28-2)13-21-20(24)18-11-15(23(25)26)3-4-19(18)22-5-7-29-8-6-22/h3-4,9-12H,5-8,13H2,1-2H3,(H,21,24) |
| InChIKey | HCAOOTRTGZXBII-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 103.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.42 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|