C22H27N3O6 — CID 51956651
N-[(1R)-1-(4,5-dimethoxy-2-methylphenyl)ethyl]-2-morpholin-4-yl-5-nitrobenzamide (PubChem CID 51956651) has the molecular formula C22H27N3O6 and a molecular weight of 429.47 g/mol. Its IUPAC name is N-[(1R)-1-(4,5-dimethoxy-2-methylphenyl)ethyl]-2-morpholin-4-yl-5-nitrobenzamide.
| Compound Name | N-[(1R)-1-(4,5-dimethoxy-2-methylphenyl)ethyl]-2-morpholin-4-yl-5-nitrobenzamide |
|---|---|
| PubChem CID | 51956651 |
| Molecular Formula | C22H27N3O6 |
| Molecular Weight | 429.47 g/mol |
| Exact Mass | 429.19 |
| IUPAC Name | N-[(1R)-1-(4,5-dimethoxy-2-methylphenyl)ethyl]-2-morpholin-4-yl-5-nitrobenzamide |
| SMILES | COc1cc(C)c([C@@H](C)NC(=O)c2cc([N+](=O)[O-])ccc2N2CCOCC2)cc1OC |
| InChI | InChI=1S/C22H27N3O6/c1-14-11-20(29-3)21(30-4)13-17(14)15(2)23-22(26)18-12-16(25(27)28)5-6-19(18)24-7-9-31-10-8-24/h5-6,11-13,15H,7-10H2,1-4H3,(H,23,26)/t15-/m1/s1 |
| InChIKey | HPERXAWMQGBLMT-OAHLLOKOSA-N |
| XLogP | 3.25 |
| TPSA | 103.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.47 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|