C22H26N4O6 — CID 55342004
N'-[2-(2,3-dimethylphenoxy)propanoyl]-2-morpholin-4-yl-5-nitrobenzohydrazide (PubChem CID 55342004) has the molecular formula C22H26N4O6 and a molecular weight of 442.47 g/mol. Its IUPAC name is N'-[2-(2,3-dimethylphenoxy)propanoyl]-2-morpholin-4-yl-5-nitrobenzohydrazide.
| Compound Name | N'-[2-(2,3-dimethylphenoxy)propanoyl]-2-morpholin-4-yl-5-nitrobenzohydrazide |
|---|---|
| PubChem CID | 55342004 |
| Molecular Formula | C22H26N4O6 |
| Molecular Weight | 442.47 g/mol |
| Exact Mass | 442.19 |
| IUPAC Name | N'-[2-(2,3-dimethylphenoxy)propanoyl]-2-morpholin-4-yl-5-nitrobenzohydrazide |
| SMILES | Cc1cccc(OC(C)C(=O)NNC(=O)c2cc([N+](=O)[O-])ccc2N2CCOCC2)c1C |
| InChI | InChI=1S/C22H26N4O6/c1-14-5-4-6-20(15(14)2)32-16(3)21(27)23-24-22(28)18-13-17(26(29)30)7-8-19(18)25-9-11-31-12-10-25/h4-8,13,16H,9-12H2,1-3H3,(H,23,27)(H,24,28) |
| InChIKey | XKTFFPAJKNNWBE-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 123.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.47 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|