C24H25N5O5 — CID 55376115
2,5-dimethyl-N'-(2-morpholin-4-yl-5-nitrobenzoyl)-1-phenylpyrrole-3-carbohydrazide (PubChem CID 55376115) has the molecular formula C24H25N5O5 and a molecular weight of 463.49 g/mol. Its IUPAC name is 2,5-dimethyl-N'-(2-morpholin-4-yl-5-nitrobenzoyl)-1-phenylpyrrole-3-carbohydrazide.
| Compound Name | 2,5-dimethyl-N'-(2-morpholin-4-yl-5-nitrobenzoyl)-1-phenylpyrrole-3-carbohydrazide |
|---|---|
| PubChem CID | 55376115 |
| Molecular Formula | C24H25N5O5 |
| Molecular Weight | 463.49 g/mol |
| Exact Mass | 463.19 |
| IUPAC Name | 2,5-dimethyl-N'-(2-morpholin-4-yl-5-nitrobenzoyl)-1-phenylpyrrole-3-carbohydrazide |
| SMILES | Cc1cc(C(=O)NNC(=O)c2cc([N+](=O)[O-])ccc2N2CCOCC2)c(C)n1-c1ccccc1 |
| InChI | InChI=1S/C24H25N5O5/c1-16-14-20(17(2)28(16)18-6-4-3-5-7-18)23(30)25-26-24(31)21-15-19(29(32)33)8-9-22(21)27-10-12-34-13-11-27/h3-9,14-15H,10-13H2,1-2H3,(H,25,30)(H,26,31) |
| InChIKey | UYZIGWJGFXEJDU-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 118.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.49 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|