C25H33N3O6 — CID 46644047
N-[1-(3,4-diethoxyphenyl)-2-methylpropyl]-2-morpholin-4-yl-5-nitrobenzamide (PubChem CID 46644047) has the molecular formula C25H33N3O6 and a molecular weight of 471.55 g/mol. Its IUPAC name is N-[1-(3,4-diethoxyphenyl)-2-methylpropyl]-2-morpholin-4-yl-5-nitrobenzamide.
| Compound Name | N-[1-(3,4-diethoxyphenyl)-2-methylpropyl]-2-morpholin-4-yl-5-nitrobenzamide |
|---|---|
| PubChem CID | 46644047 |
| Molecular Formula | C25H33N3O6 |
| Molecular Weight | 471.55 g/mol |
| Exact Mass | 471.24 |
| IUPAC Name | N-[1-(3,4-diethoxyphenyl)-2-methylpropyl]-2-morpholin-4-yl-5-nitrobenzamide |
| SMILES | CCOc1ccc(C(NC(=O)c2cc([N+](=O)[O-])ccc2N2CCOCC2)C(C)C)cc1OCC |
| InChI | InChI=1S/C25H33N3O6/c1-5-33-22-10-7-18(15-23(22)34-6-2)24(17(3)4)26-25(29)20-16-19(28(30)31)8-9-21(20)27-11-13-32-14-12-27/h7-10,15-17,24H,5-6,11-14H2,1-4H3,(H,26,29) |
| InChIKey | YOBWUEWSIRJKPB-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 103.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.55 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|