C28H31N3O6S — CID 3257110
N-(2,5-diethoxy-4-morpholin-4-ylphenyl)-2-(4-methylphenyl)sulfanyl-5-nitrobenzamide (PubChem CID 3257110) has the molecular formula C28H31N3O6S and a molecular weight of 537.64 g/mol. Its IUPAC name is N-(2,5-diethoxy-4-morpholin-4-ylphenyl)-2-(4-methylphenyl)sulfanyl-5-nitrobenzamide.
| Compound Name | N-(2,5-diethoxy-4-morpholin-4-ylphenyl)-2-(4-methylphenyl)sulfanyl-5-nitrobenzamide |
|---|---|
| PubChem CID | 3257110 |
| Molecular Formula | C28H31N3O6S |
| Molecular Weight | 537.64 g/mol |
| Exact Mass | 537.19 |
| IUPAC Name | N-(2,5-diethoxy-4-morpholin-4-ylphenyl)-2-(4-methylphenyl)sulfanyl-5-nitrobenzamide |
| SMILES | CCOc1cc(N2CCOCC2)c(OCC)cc1NC(=O)c1cc([N+](=O)[O-])ccc1Sc1ccc(C)cc1 |
| InChI | InChI=1S/C28H31N3O6S/c1-4-36-25-18-24(30-12-14-35-15-13-30)26(37-5-2)17-23(25)29-28(32)22-16-20(31(33)34)8-11-27(22)38-21-9-6-19(3)7-10-21/h6-11,16-18H,4-5,12-15H2,1-3H3,(H,29,32) |
| InChIKey | URDJUNGKHNTIKT-UHFFFAOYSA-N |
| XLogP | 5.94 |
| TPSA | 103.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.64 |
| LogP ≤ 5 | 5.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|