C25H32FN3O7S — CID 3686444
N-(2,5-diethoxy-4-morpholin-4-ylphenyl)-2-fluoro-5-morpholin-4-ylsulfonylbenzamide (PubChem CID 3686444) has the molecular formula C25H32FN3O7S and a molecular weight of 537.61 g/mol. Its IUPAC name is N-(2,5-diethoxy-4-morpholin-4-ylphenyl)-2-fluoro-5-morpholin-4-ylsulfonylbenzamide.
| Compound Name | N-(2,5-diethoxy-4-morpholin-4-ylphenyl)-2-fluoro-5-morpholin-4-ylsulfonylbenzamide |
|---|---|
| PubChem CID | 3686444 |
| Molecular Formula | C25H32FN3O7S |
| Molecular Weight | 537.61 g/mol |
| Exact Mass | 537.19 |
| IUPAC Name | N-(2,5-diethoxy-4-morpholin-4-ylphenyl)-2-fluoro-5-morpholin-4-ylsulfonylbenzamide |
| SMILES | CCOc1cc(N2CCOCC2)c(OCC)cc1NC(=O)c1cc(S(=O)(=O)N2CCOCC2)ccc1F |
| InChI | InChI=1S/C25H32FN3O7S/c1-3-35-23-17-22(28-7-11-33-12-8-28)24(36-4-2)16-21(23)27-25(30)19-15-18(5-6-20(19)26)37(31,32)29-9-13-34-14-10-29/h5-6,15-17H,3-4,7-14H2,1-2H3,(H,27,30) |
| InChIKey | HSTUEIMJAXJCTE-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 106.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.61 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|