C20H30N4O3 — CID 55961980
N-[2-(3,5-dimethylpiperidin-1-yl)ethyl]-5-nitro-2-pyrrolidin-1-ylbenzamide (PubChem CID 55961980) has the molecular formula C20H30N4O3 and a molecular weight of 374.49 g/mol. Its IUPAC name is N-[2-(3,5-dimethylpiperidin-1-yl)ethyl]-5-nitro-2-pyrrolidin-1-ylbenzamide.
| Compound Name | N-[2-(3,5-dimethylpiperidin-1-yl)ethyl]-5-nitro-2-pyrrolidin-1-ylbenzamide |
|---|---|
| PubChem CID | 55961980 |
| Molecular Formula | C20H30N4O3 |
| Molecular Weight | 374.49 g/mol |
| Exact Mass | 374.23 |
| IUPAC Name | N-[2-(3,5-dimethylpiperidin-1-yl)ethyl]-5-nitro-2-pyrrolidin-1-ylbenzamide |
| SMILES | CC1CC(C)CN(CCNC(=O)c2cc([N+](=O)[O-])ccc2N2CCCC2)C1 |
| InChI | InChI=1S/C20H30N4O3/c1-15-11-16(2)14-22(13-15)10-7-21-20(25)18-12-17(24(26)27)5-6-19(18)23-8-3-4-9-23/h5-6,12,15-16H,3-4,7-11,13-14H2,1-2H3,(H,21,25) |
| InChIKey | NNOYZNDKAVIVAG-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 78.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.49 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|