C18H26N4O7 — CID 18858561
4-(2-methoxy-4-nitroanilino)-2-(3-morpholin-4-ylpropylamino)-4-oxobutanoic acid (PubChem CID 18858561) has the molecular formula C18H26N4O7 and a molecular weight of 410.43 g/mol. Its IUPAC name is 4-(2-methoxy-4-nitroanilino)-2-(3-morpholin-4-ylpropylamino)-4-oxobutanoic acid.
| Compound Name | 4-(2-methoxy-4-nitroanilino)-2-(3-morpholin-4-ylpropylamino)-4-oxobutanoic acid |
|---|---|
| PubChem CID | 18858561 |
| Molecular Formula | C18H26N4O7 |
| Molecular Weight | 410.43 g/mol |
| Exact Mass | 410.18 |
| IUPAC Name | 4-(2-methoxy-4-nitroanilino)-2-(3-morpholin-4-ylpropylamino)-4-oxobutanoic acid |
| SMILES | COc1cc([N+](=O)[O-])ccc1NC(=O)CC(NCCCN1CCOCC1)C(=O)O |
| InChI | InChI=1S/C18H26N4O7/c1-28-16-11-13(22(26)27)3-4-14(16)20-17(23)12-15(18(24)25)19-5-2-6-21-7-9-29-10-8-21/h3-4,11,15,19H,2,5-10,12H2,1H3,(H,20,23)(H,24,25) |
| InChIKey | WMZQZQPBOHVSNZ-UHFFFAOYSA-N |
| XLogP | 0.70 |
| TPSA | 143.27 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.43 |
| LogP ≤ 5 | 0.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|