C15H20N4O5 — CID 7585342
N-(3-morpholin-4-ylpropyl)-N'-(2-nitrophenyl)oxamide (PubChem CID 7585342) has the molecular formula C15H20N4O5 and a molecular weight of 336.35 g/mol. Its IUPAC name is N-(3-morpholin-4-ylpropyl)-N'-(2-nitrophenyl)oxamide.
| Compound Name | N-(3-morpholin-4-ylpropyl)-N'-(2-nitrophenyl)oxamide |
|---|---|
| PubChem CID | 7585342 |
| Molecular Formula | C15H20N4O5 |
| Molecular Weight | 336.35 g/mol |
| Exact Mass | 336.14 |
| IUPAC Name | N-(3-morpholin-4-ylpropyl)-N'-(2-nitrophenyl)oxamide |
| SMILES | O=C(NCCCN1CCOCC1)C(=O)Nc1ccccc1[N+](=O)[O-] |
| InChI | InChI=1S/C15H20N4O5/c20-14(16-6-3-7-18-8-10-24-11-9-18)15(21)17-12-4-1-2-5-13(12)19(22)23/h1-2,4-5H,3,6-11H2,(H,16,20)(H,17,21) |
| InChIKey | XULIVBKTIHOQLN-UHFFFAOYSA-N |
| XLogP | 0.37 |
| TPSA | 113.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.35 |
| LogP ≤ 5 | 0.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|