C15H20ClN3O3 — CID 2291374
N'-(2-chlorophenyl)-N-(3-morpholin-4-ylpropyl)oxamide (PubChem CID 2291374) has the molecular formula C15H20ClN3O3 and a molecular weight of 325.80 g/mol. Its IUPAC name is N'-(2-chlorophenyl)-N-(3-morpholin-4-ylpropyl)oxamide.
| Compound Name | N'-(2-chlorophenyl)-N-(3-morpholin-4-ylpropyl)oxamide |
|---|---|
| PubChem CID | 2291374 |
| Molecular Formula | C15H20ClN3O3 |
| Molecular Weight | 325.80 g/mol |
| Exact Mass | 325.12 |
| IUPAC Name | N'-(2-chlorophenyl)-N-(3-morpholin-4-ylpropyl)oxamide |
| SMILES | O=C(NCCCN1CCOCC1)C(=O)Nc1ccccc1Cl |
| InChI | InChI=1S/C15H20ClN3O3/c16-12-4-1-2-5-13(12)18-15(21)14(20)17-6-3-7-19-8-10-22-11-9-19/h1-2,4-5H,3,6-11H2,(H,17,20)(H,18,21) |
| InChIKey | PCIGNGHTQQAOPN-UHFFFAOYSA-N |
| XLogP | 1.12 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.80 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|