C16H22N4O4 — CID 7584971
N'-(4-carbamoylphenyl)-N-(3-morpholin-4-ylpropyl)oxamide (PubChem CID 7584971) has the molecular formula C16H22N4O4 and a molecular weight of 334.38 g/mol. Its IUPAC name is N'-(4-carbamoylphenyl)-N-(3-morpholin-4-ylpropyl)oxamide.
| Compound Name | N'-(4-carbamoylphenyl)-N-(3-morpholin-4-ylpropyl)oxamide |
|---|---|
| PubChem CID | 7584971 |
| Molecular Formula | C16H22N4O4 |
| Molecular Weight | 334.38 g/mol |
| Exact Mass | 334.16 |
| IUPAC Name | N'-(4-carbamoylphenyl)-N-(3-morpholin-4-ylpropyl)oxamide |
| SMILES | NC(=O)c1ccc(NC(=O)C(=O)NCCCN2CCOCC2)cc1 |
| InChI | InChI=1S/C16H22N4O4/c17-14(21)12-2-4-13(5-3-12)19-16(23)15(22)18-6-1-7-20-8-10-24-11-9-20/h2-5H,1,6-11H2,(H2,17,21)(H,18,22)(H,19,23) |
| InChIKey | QEGVEGYPYIRHME-UHFFFAOYSA-N |
| XLogP | -0.44 |
| TPSA | 113.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.38 |
| LogP ≤ 5 | -0.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|