C16H20Cl2N4O3 — CID 3128229
N'-[(2,6-dichlorophenyl)methylideneamino]-N-(3-morpholin-4-ylpropyl)oxamide (PubChem CID 3128229) has the molecular formula C16H20Cl2N4O3 and a molecular weight of 387.27 g/mol. Its IUPAC name is N'-[(2,6-dichlorophenyl)methylideneamino]-N-(3-morpholin-4-ylpropyl)oxamide.
| Compound Name | N'-[(2,6-dichlorophenyl)methylideneamino]-N-(3-morpholin-4-ylpropyl)oxamide |
|---|---|
| PubChem CID | 3128229 |
| Molecular Formula | C16H20Cl2N4O3 |
| Molecular Weight | 387.27 g/mol |
| Exact Mass | 386.09 |
| IUPAC Name | N'-[(2,6-dichlorophenyl)methylideneamino]-N-(3-morpholin-4-ylpropyl)oxamide |
| SMILES | O=C(NCCCN1CCOCC1)C(=O)NN=Cc1c(Cl)cccc1Cl |
| InChI | InChI=1S/C16H20Cl2N4O3/c17-13-3-1-4-14(18)12(13)11-20-21-16(24)15(23)19-5-2-6-22-7-9-25-10-8-22/h1,3-4,11H,2,5-10H2,(H,19,23)(H,21,24) |
| InChIKey | WMLKTVVJJSAFQD-UHFFFAOYSA-N |
| XLogP | 1.28 |
| TPSA | 83.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.27 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|