C21H24Cl2N6O3 — CID 73226716
3-[[2-[2-[(3,5-dichloro-4-pyridinyl)methylidene]hydrazinyl]-2-oxoethyl]amino]-N-(2-morpholin-4-ylethyl)benzamide (PubChem CID 73226716) has the molecular formula C21H24Cl2N6O3 and a molecular weight of 479.37 g/mol. Its IUPAC name is 3-[[2-[2-[(3,5-dichloro-4-pyridinyl)methylidene]hydrazinyl]-2-oxoethyl]amino]-N-(2-morpholin-4-ylethyl)benzamide.
| Compound Name | 3-[[2-[2-[(3,5-dichloro-4-pyridinyl)methylidene]hydrazinyl]-2-oxoethyl]amino]-N-(2-morpholin-4-ylethyl)benzamide |
|---|---|
| PubChem CID | 73226716 |
| Molecular Formula | C21H24Cl2N6O3 |
| Molecular Weight | 479.37 g/mol |
| Exact Mass | 478.13 |
| IUPAC Name | 3-[[2-[2-[(3,5-dichloro-4-pyridinyl)methylidene]hydrazinyl]-2-oxoethyl]amino]-N-(2-morpholin-4-ylethyl)benzamide |
| SMILES | O=C(CNc1cccc(C(=O)NCCN2CCOCC2)c1)NN=Cc1c(Cl)cncc1Cl |
| InChI | InChI=1S/C21H24Cl2N6O3/c22-18-12-24-13-19(23)17(18)11-27-28-20(30)14-26-16-3-1-2-15(10-16)21(31)25-4-5-29-6-8-32-9-7-29/h1-3,10-13,26H,4-9,14H2,(H,25,31)(H,28,30) |
| InChIKey | DKRABYOJMLGXOH-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 107.95 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.37 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|