C17H24N4O3 — CID 94848692
N'-[(Z)-(4-ethylphenyl)methylideneamino]-N-(2-morpholin-4-ylethyl)oxamide (PubChem CID 94848692) has the molecular formula C17H24N4O3 and a molecular weight of 332.40 g/mol. Its IUPAC name is N'-[(Z)-(4-ethylphenyl)methylideneamino]-N-(2-morpholin-4-ylethyl)oxamide.
| Compound Name | N'-[(Z)-(4-ethylphenyl)methylideneamino]-N-(2-morpholin-4-ylethyl)oxamide |
|---|---|
| PubChem CID | 94848692 |
| Molecular Formula | C17H24N4O3 |
| Molecular Weight | 332.40 g/mol |
| Exact Mass | 332.18 |
| IUPAC Name | N'-[(Z)-(4-ethylphenyl)methylideneamino]-N-(2-morpholin-4-ylethyl)oxamide |
| SMILES | CCc1ccc(/C=N\NC(=O)C(=O)NCCN2CCOCC2)cc1 |
| InChI | InChI=1S/C17H24N4O3/c1-2-14-3-5-15(6-4-14)13-19-20-17(23)16(22)18-7-8-21-9-11-24-12-10-21/h3-6,13H,2,7-12H2,1H3,(H,18,22)(H,20,23)/b19-13- |
| InChIKey | GETGVQAHSWFTPZ-UYRXBGFRSA-N |
| XLogP | 0.15 |
| TPSA | 83.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.40 |
| LogP ≤ 5 | 0.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|