C15H21N3O2 — CID 40538842
N'-[(Z)-(4-ethylphenyl)methylideneamino]-N-(2-methylpropyl)oxamide (PubChem CID 40538842) has the molecular formula C15H21N3O2 and a molecular weight of 275.35 g/mol. Its IUPAC name is N'-[(Z)-(4-ethylphenyl)methylideneamino]-N-(2-methylpropyl)oxamide.
| Compound Name | N'-[(Z)-(4-ethylphenyl)methylideneamino]-N-(2-methylpropyl)oxamide |
|---|---|
| PubChem CID | 40538842 |
| Molecular Formula | C15H21N3O2 |
| Molecular Weight | 275.35 g/mol |
| Exact Mass | 275.16 |
| IUPAC Name | N'-[(Z)-(4-ethylphenyl)methylideneamino]-N-(2-methylpropyl)oxamide |
| SMILES | CCc1ccc(/C=N\NC(=O)C(=O)NCC(C)C)cc1 |
| InChI | InChI=1S/C15H21N3O2/c1-4-12-5-7-13(8-6-12)10-17-18-15(20)14(19)16-9-11(2)3/h5-8,10-11H,4,9H2,1-3H3,(H,16,19)(H,18,20)/b17-10- |
| InChIKey | PNGUCXPROMZCLV-YVLHZVERSA-N |
| XLogP | 1.47 |
| TPSA | 70.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.35 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|