C17H25N3O3 — CID 21212792
N'-[(E)-(4-butoxyphenyl)methylideneamino]-N-(2-methylpropyl)oxamide (PubChem CID 21212792) has the molecular formula C17H25N3O3 and a molecular weight of 319.41 g/mol. Its IUPAC name is N'-[(E)-(4-butoxyphenyl)methylideneamino]-N-(2-methylpropyl)oxamide.
| Compound Name | N'-[(E)-(4-butoxyphenyl)methylideneamino]-N-(2-methylpropyl)oxamide |
|---|---|
| PubChem CID | 21212792 |
| Molecular Formula | C17H25N3O3 |
| Molecular Weight | 319.41 g/mol |
| Exact Mass | 319.19 |
| IUPAC Name | N'-[(E)-(4-butoxyphenyl)methylideneamino]-N-(2-methylpropyl)oxamide |
| SMILES | CCCCOc1ccc(/C=N/NC(=O)C(=O)NCC(C)C)cc1 |
| InChI | InChI=1S/C17H25N3O3/c1-4-5-10-23-15-8-6-14(7-9-15)12-19-20-17(22)16(21)18-11-13(2)3/h6-9,12-13H,4-5,10-11H2,1-3H3,(H,18,21)(H,20,22)/b19-12+ |
| InChIKey | UXZQBRYMQMMSSC-XDHOZWIPSA-N |
| XLogP | 2.09 |
| TPSA | 79.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.41 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|