C21H23N3O5 — CID 8898148
5-[(Z)-[[2-(2-methylpropylamino)-2-oxoacetyl]hydrazinylidene]methyl]-2-phenylmethoxybenzoic acid (PubChem CID 8898148) has the molecular formula C21H23N3O5 and a molecular weight of 397.43 g/mol. Its IUPAC name is 5-[(Z)-[[2-(2-methylpropylamino)-2-oxoacetyl]hydrazinylidene]methyl]-2-phenylmethoxybenzoic acid.
| Compound Name | 5-[(Z)-[[2-(2-methylpropylamino)-2-oxoacetyl]hydrazinylidene]methyl]-2-phenylmethoxybenzoic acid |
|---|---|
| PubChem CID | 8898148 |
| Molecular Formula | C21H23N3O5 |
| Molecular Weight | 397.43 g/mol |
| Exact Mass | 397.16 |
| IUPAC Name | 5-[(Z)-[[2-(2-methylpropylamino)-2-oxoacetyl]hydrazinylidene]methyl]-2-phenylmethoxybenzoic acid |
| SMILES | CC(C)CNC(=O)C(=O)N/N=C\c1ccc(OCc2ccccc2)c(C(=O)O)c1 |
| InChI | InChI=1S/C21H23N3O5/c1-14(2)11-22-19(25)20(26)24-23-12-16-8-9-18(17(10-16)21(27)28)29-13-15-6-4-3-5-7-15/h3-10,12,14H,11,13H2,1-2H3,(H,22,25)(H,24,26)(H,27,28)/b23-12- |
| InChIKey | YQANCOIERQFXSW-FMCGGJTJSA-N |
| XLogP | 2.19 |
| TPSA | 117.09 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.43 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|