C15H19BrN4O4 — CID 8990262
N'-[(Z)-[4-(2-amino-2-oxoethoxy)-3-bromophenyl]methylideneamino]-N-(2-methylpropyl)oxamide (PubChem CID 8990262) has the molecular formula C15H19BrN4O4 and a molecular weight of 399.25 g/mol. Its IUPAC name is N'-[(Z)-[4-(2-amino-2-oxoethoxy)-3-bromophenyl]methylideneamino]-N-(2-methylpropyl)oxamide.
| Compound Name | N'-[(Z)-[4-(2-amino-2-oxoethoxy)-3-bromophenyl]methylideneamino]-N-(2-methylpropyl)oxamide |
|---|---|
| PubChem CID | 8990262 |
| Molecular Formula | C15H19BrN4O4 |
| Molecular Weight | 399.25 g/mol |
| Exact Mass | 398.06 |
| IUPAC Name | N'-[(Z)-[4-(2-amino-2-oxoethoxy)-3-bromophenyl]methylideneamino]-N-(2-methylpropyl)oxamide |
| SMILES | CC(C)CNC(=O)C(=O)N/N=C\c1ccc(OCC(N)=O)c(Br)c1 |
| InChI | InChI=1S/C15H19BrN4O4/c1-9(2)6-18-14(22)15(23)20-19-7-10-3-4-12(11(16)5-10)24-8-13(17)21/h3-5,7,9H,6,8H2,1-2H3,(H2,17,21)(H,18,22)(H,20,23)/b19-7- |
| InChIKey | SNYTXCMSINEDCE-GXHLCREISA-N |
| XLogP | 0.54 |
| TPSA | 122.88 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.25 |
| LogP ≤ 5 | 0.54 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|