C14H17BrN4O5 — CID 8990255
N'-[(Z)-[4-(2-amino-2-oxoethoxy)-3-bromophenyl]methylideneamino]-N-(2-methoxyethyl)oxamide (PubChem CID 8990255) has the molecular formula C14H17BrN4O5 and a molecular weight of 401.22 g/mol. Its IUPAC name is N'-[(Z)-[4-(2-amino-2-oxoethoxy)-3-bromophenyl]methylideneamino]-N-(2-methoxyethyl)oxamide.
| Compound Name | N'-[(Z)-[4-(2-amino-2-oxoethoxy)-3-bromophenyl]methylideneamino]-N-(2-methoxyethyl)oxamide |
|---|---|
| PubChem CID | 8990255 |
| Molecular Formula | C14H17BrN4O5 |
| Molecular Weight | 401.22 g/mol |
| Exact Mass | 400.04 |
| IUPAC Name | N'-[(Z)-[4-(2-amino-2-oxoethoxy)-3-bromophenyl]methylideneamino]-N-(2-methoxyethyl)oxamide |
| SMILES | COCCNC(=O)C(=O)N/N=C\c1ccc(OCC(N)=O)c(Br)c1 |
| InChI | InChI=1S/C14H17BrN4O5/c1-23-5-4-17-13(21)14(22)19-18-7-9-2-3-11(10(15)6-9)24-8-12(16)20/h2-3,6-7H,4-5,8H2,1H3,(H2,16,20)(H,17,21)(H,19,22)/b18-7- |
| InChIKey | TUGWDERIZQORIP-WSVATBPTSA-N |
| XLogP | -0.47 |
| TPSA | 132.11 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.22 |
| LogP ≤ 5 | -0.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|