C21H22N3O5- — CID 8989510
4-[[3-[(Z)-[[2-(2-methylpropylamino)-2-oxoacetyl]hydrazinylidene]methyl]phenoxy]methyl]benzoate (PubChem CID 8989510) has the molecular formula C21H22N3O5- and a molecular weight of 396.42 g/mol. Its IUPAC name is 4-[[3-[(Z)-[[2-(2-methylpropylamino)-2-oxoacetyl]hydrazinylidene]methyl]phenoxy]methyl]benzoate.
| Compound Name | 4-[[3-[(Z)-[[2-(2-methylpropylamino)-2-oxoacetyl]hydrazinylidene]methyl]phenoxy]methyl]benzoate |
|---|---|
| PubChem CID | 8989510 |
| Molecular Formula | C21H22N3O5- |
| Molecular Weight | 396.42 g/mol |
| Exact Mass | 396.16 |
| IUPAC Name | 4-[[3-[(Z)-[[2-(2-methylpropylamino)-2-oxoacetyl]hydrazinylidene]methyl]phenoxy]methyl]benzoate |
| SMILES | CC(C)CNC(=O)C(=O)N/N=C\c1cccc(OCc2ccc(C(=O)[O-])cc2)c1 |
| InChI | InChI=1S/C21H23N3O5/c1-14(2)11-22-19(25)20(26)24-23-12-16-4-3-5-18(10-16)29-13-15-6-8-17(9-7-15)21(27)28/h3-10,12,14H,11,13H2,1-2H3,(H,22,25)(H,24,26)(H,27,28)/p-1/b23-12- |
| InChIKey | YTLKPSDJQXNOHS-FMCGGJTJSA-M |
| XLogP | 0.85 |
| TPSA | 119.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.42 |
| LogP ≤ 5 | 0.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|