C26H27N3O5 — CID 21212848
N-[2-(3,4-dimethoxyphenyl)ethyl]-N'-[(E)-(3-phenylmethoxyphenyl)methylideneamino]oxamide (PubChem CID 21212848) has the molecular formula C26H27N3O5 and a molecular weight of 461.52 g/mol. Its IUPAC name is N-[2-(3,4-dimethoxyphenyl)ethyl]-N'-[(E)-(3-phenylmethoxyphenyl)methylideneamino]oxamide.
| Compound Name | N-[2-(3,4-dimethoxyphenyl)ethyl]-N'-[(E)-(3-phenylmethoxyphenyl)methylideneamino]oxamide |
|---|---|
| PubChem CID | 21212848 |
| Molecular Formula | C26H27N3O5 |
| Molecular Weight | 461.52 g/mol |
| Exact Mass | 461.20 |
| IUPAC Name | N-[2-(3,4-dimethoxyphenyl)ethyl]-N'-[(E)-(3-phenylmethoxyphenyl)methylideneamino]oxamide |
| SMILES | COc1ccc(CCNC(=O)C(=O)N/N=C/c2cccc(OCc3ccccc3)c2)cc1OC |
| InChI | InChI=1S/C26H27N3O5/c1-32-23-12-11-19(16-24(23)33-2)13-14-27-25(30)26(31)29-28-17-21-9-6-10-22(15-21)34-18-20-7-4-3-5-8-20/h3-12,15-17H,13-14,18H2,1-2H3,(H,27,30)(H,29,31)/b28-17+ |
| InChIKey | GCAODOYXTGLWPR-OGLMXYFKSA-N |
| XLogP | 3.09 |
| TPSA | 98.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.52 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|