C20H23N3O5 — CID 8900282
N-[2-(3,4-dimethoxyphenyl)ethyl]-N'-[(Z)-(4-methoxyphenyl)methylideneamino]oxamide (PubChem CID 8900282) has the molecular formula C20H23N3O5 and a molecular weight of 385.42 g/mol. Its IUPAC name is N-[2-(3,4-dimethoxyphenyl)ethyl]-N'-[(Z)-(4-methoxyphenyl)methylideneamino]oxamide.
| Compound Name | N-[2-(3,4-dimethoxyphenyl)ethyl]-N'-[(Z)-(4-methoxyphenyl)methylideneamino]oxamide |
|---|---|
| PubChem CID | 8900282 |
| Molecular Formula | C20H23N3O5 |
| Molecular Weight | 385.42 g/mol |
| Exact Mass | 385.16 |
| IUPAC Name | N-[2-(3,4-dimethoxyphenyl)ethyl]-N'-[(Z)-(4-methoxyphenyl)methylideneamino]oxamide |
| SMILES | COc1ccc(/C=N\NC(=O)C(=O)NCCc2ccc(OC)c(OC)c2)cc1 |
| InChI | InChI=1S/C20H23N3O5/c1-26-16-7-4-15(5-8-16)13-22-23-20(25)19(24)21-11-10-14-6-9-17(27-2)18(12-14)28-3/h4-9,12-13H,10-11H2,1-3H3,(H,21,24)(H,23,25)/b22-13- |
| InChIKey | ZYJIILJOWJKPNW-XKZIYDEJSA-N |
| XLogP | 1.52 |
| TPSA | 98.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.42 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|