C29H32N4O7 — CID 98102295
N-[2-(3,4-dimethoxyphenyl)ethyl]-N'-[(E)-[4-[2-(4-methoxyanilino)-2-oxoethoxy]phenyl]methylideneamino]propanediamide (PubChem CID 98102295) has the molecular formula C29H32N4O7 and a molecular weight of 548.60 g/mol. Its IUPAC name is N-[2-(3,4-dimethoxyphenyl)ethyl]-N'-[(E)-[4-[2-(4-methoxyanilino)-2-oxoethoxy]phenyl]methylideneamino]propanediamide.
| Compound Name | N-[2-(3,4-dimethoxyphenyl)ethyl]-N'-[(E)-[4-[2-(4-methoxyanilino)-2-oxoethoxy]phenyl]methylideneamino]propanediamide |
|---|---|
| PubChem CID | 98102295 |
| Molecular Formula | C29H32N4O7 |
| Molecular Weight | 548.60 g/mol |
| Exact Mass | 548.23 |
| IUPAC Name | N-[2-(3,4-dimethoxyphenyl)ethyl]-N'-[(E)-[4-[2-(4-methoxyanilino)-2-oxoethoxy]phenyl]methylideneamino]propanediamide |
| SMILES | COc1ccc(NC(=O)COc2ccc(/C=N/NC(=O)CC(=O)NCCc3ccc(OC)c(OC)c3)cc2)cc1 |
| InChI | InChI=1S/C29H32N4O7/c1-37-23-11-7-22(8-12-23)32-29(36)19-40-24-9-4-21(5-10-24)18-31-33-28(35)17-27(34)30-15-14-20-6-13-25(38-2)26(16-20)39-3/h4-13,16,18H,14-15,17,19H2,1-3H3,(H,30,34)(H,32,36)(H,33,35)/b31-18+ |
| InChIKey | KAKRCKCJRFHDHE-FDAWAROLSA-N |
| XLogP | 2.93 |
| TPSA | 136.58 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.60 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|