C26H25FN4O4 — CID 94832214
N'-[(E)-[4-[2-(4-fluoroanilino)-2-oxoethoxy]phenyl]methylideneamino]-N-(2-phenylethyl)propanediamide (PubChem CID 94832214) has the molecular formula C26H25FN4O4 and a molecular weight of 476.51 g/mol. Its IUPAC name is N'-[(E)-[4-[2-(4-fluoroanilino)-2-oxoethoxy]phenyl]methylideneamino]-N-(2-phenylethyl)propanediamide.
| Compound Name | N'-[(E)-[4-[2-(4-fluoroanilino)-2-oxoethoxy]phenyl]methylideneamino]-N-(2-phenylethyl)propanediamide |
|---|---|
| PubChem CID | 94832214 |
| Molecular Formula | C26H25FN4O4 |
| Molecular Weight | 476.51 g/mol |
| Exact Mass | 476.19 |
| IUPAC Name | N'-[(E)-[4-[2-(4-fluoroanilino)-2-oxoethoxy]phenyl]methylideneamino]-N-(2-phenylethyl)propanediamide |
| SMILES | O=C(CC(=O)N/N=C/c1ccc(OCC(=O)Nc2ccc(F)cc2)cc1)NCCc1ccccc1 |
| InChI | InChI=1S/C26H25FN4O4/c27-21-8-10-22(11-9-21)30-26(34)18-35-23-12-6-20(7-13-23)17-29-31-25(33)16-24(32)28-15-14-19-4-2-1-3-5-19/h1-13,17H,14-16,18H2,(H,28,32)(H,30,34)(H,31,33)/b29-17+ |
| InChIKey | LRPRPVFRVHJEME-STBIYBPSSA-N |
| XLogP | 3.04 |
| TPSA | 108.89 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.51 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|