C26H26N4O5 — CID 94832239
N-benzyl-N'-[(E)-[4-[2-(2-methoxyanilino)-2-oxoethoxy]phenyl]methylideneamino]propanediamide (PubChem CID 94832239) has the molecular formula C26H26N4O5 and a molecular weight of 474.52 g/mol. Its IUPAC name is N-benzyl-N'-[(E)-[4-[2-(2-methoxyanilino)-2-oxoethoxy]phenyl]methylideneamino]propanediamide.
| Compound Name | N-benzyl-N'-[(E)-[4-[2-(2-methoxyanilino)-2-oxoethoxy]phenyl]methylideneamino]propanediamide |
|---|---|
| PubChem CID | 94832239 |
| Molecular Formula | C26H26N4O5 |
| Molecular Weight | 474.52 g/mol |
| Exact Mass | 474.19 |
| IUPAC Name | N-benzyl-N'-[(E)-[4-[2-(2-methoxyanilino)-2-oxoethoxy]phenyl]methylideneamino]propanediamide |
| SMILES | COc1ccccc1NC(=O)COc1ccc(/C=N/NC(=O)CC(=O)NCc2ccccc2)cc1 |
| InChI | InChI=1S/C26H26N4O5/c1-34-23-10-6-5-9-22(23)29-26(33)18-35-21-13-11-20(12-14-21)17-28-30-25(32)15-24(31)27-16-19-7-3-2-4-8-19/h2-14,17H,15-16,18H2,1H3,(H,27,31)(H,29,33)(H,30,32)/b28-17+ |
| InChIKey | HKKPZWWLTWYQOM-OGLMXYFKSA-N |
| XLogP | 2.87 |
| TPSA | 118.12 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.52 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|