C21H23ClN4O5 — CID 3131650
N'-[[4-[2-(2-chloroanilino)-2-oxoethoxy]phenyl]methylideneamino]-N-(2-methoxyethyl)propanediamide (PubChem CID 3131650) has the molecular formula C21H23ClN4O5 and a molecular weight of 446.89 g/mol. Its IUPAC name is N'-[[4-[2-(2-chloroanilino)-2-oxoethoxy]phenyl]methylideneamino]-N-(2-methoxyethyl)propanediamide.
| Compound Name | N'-[[4-[2-(2-chloroanilino)-2-oxoethoxy]phenyl]methylideneamino]-N-(2-methoxyethyl)propanediamide |
|---|---|
| PubChem CID | 3131650 |
| Molecular Formula | C21H23ClN4O5 |
| Molecular Weight | 446.89 g/mol |
| Exact Mass | 446.14 |
| IUPAC Name | N'-[[4-[2-(2-chloroanilino)-2-oxoethoxy]phenyl]methylideneamino]-N-(2-methoxyethyl)propanediamide |
| SMILES | COCCNC(=O)CC(=O)NN=Cc1ccc(OCC(=O)Nc2ccccc2Cl)cc1 |
| InChI | InChI=1S/C21H23ClN4O5/c1-30-11-10-23-19(27)12-20(28)26-24-13-15-6-8-16(9-7-15)31-14-21(29)25-18-5-3-2-4-17(18)22/h2-9,13H,10-12,14H2,1H3,(H,23,27)(H,25,29)(H,26,28) |
| InChIKey | IJKYFHHGYCJSDC-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 118.12 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.89 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|