C24H20ClN5O3 — CID 126006738
N-[(Z)-[4-[2-(2-chloroanilino)-2-oxoethoxy]phenyl]methylideneamino]-2-methylimidazo[1,2-a]pyridine-3-carboxamide (PubChem CID 126006738) has the molecular formula C24H20ClN5O3 and a molecular weight of 461.91 g/mol. Its IUPAC name is N-[(Z)-[4-[2-(2-chloroanilino)-2-oxoethoxy]phenyl]methylideneamino]-2-methylimidazo[1,2-a]pyridine-3-carboxamide.
| Compound Name | N-[(Z)-[4-[2-(2-chloroanilino)-2-oxoethoxy]phenyl]methylideneamino]-2-methylimidazo[1,2-a]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 126006738 |
| Molecular Formula | C24H20ClN5O3 |
| Molecular Weight | 461.91 g/mol |
| Exact Mass | 461.13 |
| IUPAC Name | N-[(Z)-[4-[2-(2-chloroanilino)-2-oxoethoxy]phenyl]methylideneamino]-2-methylimidazo[1,2-a]pyridine-3-carboxamide |
| SMILES | Cc1nc2ccccn2c1C(=O)N/N=C\c1ccc(OCC(=O)Nc2ccccc2Cl)cc1 |
| InChI | InChI=1S/C24H20ClN5O3/c1-16-23(30-13-5-4-8-21(30)27-16)24(32)29-26-14-17-9-11-18(12-10-17)33-15-22(31)28-20-7-3-2-6-19(20)25/h2-14H,15H2,1H3,(H,28,31)(H,29,32)/b26-14- |
| InChIKey | XDTAKQUQHUPZIW-WGARJPEWSA-N |
| XLogP | 4.08 |
| TPSA | 97.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.91 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|