C30H26Cl2N4O5S — CID 126191378
2-[N-(benzenesulfonyl)-5-chloro-2-methylanilino]-N-[(Z)-[4-[2-(2-chloroanilino)-2-oxoethoxy]phenyl]methylideneamino]acetamide (PubChem CID 126191378) has the molecular formula C30H26Cl2N4O5S and a molecular weight of 625.53 g/mol. Its IUPAC name is 2-[N-(benzenesulfonyl)-5-chloro-2-methylanilino]-N-[(Z)-[4-[2-(2-chloroanilino)-2-oxoethoxy]phenyl]methylideneamino]acetamide.
| Compound Name | 2-[N-(benzenesulfonyl)-5-chloro-2-methylanilino]-N-[(Z)-[4-[2-(2-chloroanilino)-2-oxoethoxy]phenyl]methylideneamino]acetamide |
|---|---|
| PubChem CID | 126191378 |
| Molecular Formula | C30H26Cl2N4O5S |
| Molecular Weight | 625.53 g/mol |
| Exact Mass | 624.10 |
| IUPAC Name | 2-[N-(benzenesulfonyl)-5-chloro-2-methylanilino]-N-[(Z)-[4-[2-(2-chloroanilino)-2-oxoethoxy]phenyl]methylideneamino]acetamide |
| SMILES | Cc1ccc(Cl)cc1N(CC(=O)N/N=C\c1ccc(OCC(=O)Nc2ccccc2Cl)cc1)S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C30H26Cl2N4O5S/c1-21-11-14-23(31)17-28(21)36(42(39,40)25-7-3-2-4-8-25)19-29(37)35-33-18-22-12-15-24(16-13-22)41-20-30(38)34-27-10-6-5-9-26(27)32/h2-18H,19-20H2,1H3,(H,34,38)(H,35,37)/b33-18- |
| InChIKey | JLWRZEDYCSEAJX-OHUYPAJKSA-N |
| XLogP | 5.66 |
| TPSA | 117.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 625.53 |
| LogP ≤ 5 | 5.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|