C37H33ClN4O6S — CID 126191079
4-[[N-(benzenesulfonyl)-5-chloro-2-methylanilino]methyl]-N-[(Z)-[4-[2-(2-methoxyanilino)-2-oxoethoxy]phenyl]methylideneamino]benzamide (PubChem CID 126191079) has the molecular formula C37H33ClN4O6S and a molecular weight of 697.21 g/mol. Its IUPAC name is 4-[[N-(benzenesulfonyl)-5-chloro-2-methylanilino]methyl]-N-[(Z)-[4-[2-(2-methoxyanilino)-2-oxoethoxy]phenyl]methylideneamino]benzamide.
| Compound Name | 4-[[N-(benzenesulfonyl)-5-chloro-2-methylanilino]methyl]-N-[(Z)-[4-[2-(2-methoxyanilino)-2-oxoethoxy]phenyl]methylideneamino]benzamide |
|---|---|
| PubChem CID | 126191079 |
| Molecular Formula | C37H33ClN4O6S |
| Molecular Weight | 697.21 g/mol |
| Exact Mass | 696.18 |
| IUPAC Name | 4-[[N-(benzenesulfonyl)-5-chloro-2-methylanilino]methyl]-N-[(Z)-[4-[2-(2-methoxyanilino)-2-oxoethoxy]phenyl]methylideneamino]benzamide |
| SMILES | COc1ccccc1NC(=O)COc1ccc(/C=N\NC(=O)c2ccc(CN(c3cc(Cl)ccc3C)S(=O)(=O)c3ccccc3)cc2)cc1 |
| InChI | InChI=1S/C37H33ClN4O6S/c1-26-12-19-30(38)22-34(26)42(49(45,46)32-8-4-3-5-9-32)24-28-13-17-29(18-14-28)37(44)41-39-23-27-15-20-31(21-16-27)48-25-36(43)40-33-10-6-7-11-35(33)47-2/h3-23H,24-25H2,1-2H3,(H,40,43)(H,41,44)/b39-23- |
| InChIKey | OCESFSLZGCISNA-KDHRXPGNSA-N |
| XLogP | 6.83 |
| TPSA | 126.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 697.21 |
| LogP ≤ 5 | 6.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|