C32H32ClN3O4S — CID 98069211
4-[[N-(benzenesulfonyl)-5-chloro-2-methylanilino]methyl]-N-[(Z)-(4-butoxyphenyl)methylideneamino]benzamide (PubChem CID 98069211) has the molecular formula C32H32ClN3O4S and a molecular weight of 590.15 g/mol. Its IUPAC name is 4-[[N-(benzenesulfonyl)-5-chloro-2-methylanilino]methyl]-N-[(Z)-(4-butoxyphenyl)methylideneamino]benzamide.
| Compound Name | 4-[[N-(benzenesulfonyl)-5-chloro-2-methylanilino]methyl]-N-[(Z)-(4-butoxyphenyl)methylideneamino]benzamide |
|---|---|
| PubChem CID | 98069211 |
| Molecular Formula | C32H32ClN3O4S |
| Molecular Weight | 590.15 g/mol |
| Exact Mass | 589.18 |
| IUPAC Name | 4-[[N-(benzenesulfonyl)-5-chloro-2-methylanilino]methyl]-N-[(Z)-(4-butoxyphenyl)methylideneamino]benzamide |
| SMILES | CCCCOc1ccc(/C=N\NC(=O)c2ccc(CN(c3cc(Cl)ccc3C)S(=O)(=O)c3ccccc3)cc2)cc1 |
| InChI | InChI=1S/C32H32ClN3O4S/c1-3-4-20-40-29-18-13-25(14-19-29)22-34-35-32(37)27-15-11-26(12-16-27)23-36(31-21-28(33)17-10-24(31)2)41(38,39)30-8-6-5-7-9-30/h5-19,21-22H,3-4,20,23H2,1-2H3,(H,35,37)/b34-22- |
| InChIKey | LBEMIAORPJEWRH-VQNDASPWSA-N |
| XLogP | 6.99 |
| TPSA | 88.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 590.15 |
| LogP ≤ 5 | 6.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|