C29H25ClN4O6S — CID 98090582
4-[[N-(benzenesulfonyl)-5-chloro-2-methylanilino]methyl]-N-[(Z)-(4-methoxy-3-nitrophenyl)methylideneamino]benzamide (PubChem CID 98090582) has the molecular formula C29H25ClN4O6S and a molecular weight of 593.06 g/mol. Its IUPAC name is 4-[[N-(benzenesulfonyl)-5-chloro-2-methylanilino]methyl]-N-[(Z)-(4-methoxy-3-nitrophenyl)methylideneamino]benzamide.
| Compound Name | 4-[[N-(benzenesulfonyl)-5-chloro-2-methylanilino]methyl]-N-[(Z)-(4-methoxy-3-nitrophenyl)methylideneamino]benzamide |
|---|---|
| PubChem CID | 98090582 |
| Molecular Formula | C29H25ClN4O6S |
| Molecular Weight | 593.06 g/mol |
| Exact Mass | 592.12 |
| IUPAC Name | 4-[[N-(benzenesulfonyl)-5-chloro-2-methylanilino]methyl]-N-[(Z)-(4-methoxy-3-nitrophenyl)methylideneamino]benzamide |
| SMILES | COc1ccc(/C=N\NC(=O)c2ccc(CN(c3cc(Cl)ccc3C)S(=O)(=O)c3ccccc3)cc2)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C29H25ClN4O6S/c1-20-8-14-24(30)17-26(20)33(41(38,39)25-6-4-3-5-7-25)19-21-9-12-23(13-10-21)29(35)32-31-18-22-11-15-28(40-2)27(16-22)34(36)37/h3-18H,19H2,1-2H3,(H,32,35)/b31-18- |
| InChIKey | VYRCOQSTCQCFNJ-MNBJERMJSA-N |
| XLogP | 5.72 |
| TPSA | 131.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 593.06 |
| LogP ≤ 5 | 5.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|