C23H19Cl2N3O4 — CID 94833155
2,4-dichloro-N-[(E)-[4-[2-(2-methoxyanilino)-2-oxoethoxy]phenyl]methylideneamino]benzamide (PubChem CID 94833155) has the molecular formula C23H19Cl2N3O4 and a molecular weight of 472.33 g/mol. Its IUPAC name is 2,4-dichloro-N-[(E)-[4-[2-(2-methoxyanilino)-2-oxoethoxy]phenyl]methylideneamino]benzamide.
| Compound Name | 2,4-dichloro-N-[(E)-[4-[2-(2-methoxyanilino)-2-oxoethoxy]phenyl]methylideneamino]benzamide |
|---|---|
| PubChem CID | 94833155 |
| Molecular Formula | C23H19Cl2N3O4 |
| Molecular Weight | 472.33 g/mol |
| Exact Mass | 471.08 |
| IUPAC Name | 2,4-dichloro-N-[(E)-[4-[2-(2-methoxyanilino)-2-oxoethoxy]phenyl]methylideneamino]benzamide |
| SMILES | COc1ccccc1NC(=O)COc1ccc(/C=N/NC(=O)c2ccc(Cl)cc2Cl)cc1 |
| InChI | InChI=1S/C23H19Cl2N3O4/c1-31-21-5-3-2-4-20(21)27-22(29)14-32-17-9-6-15(7-10-17)13-26-28-23(30)18-11-8-16(24)12-19(18)25/h2-13H,14H2,1H3,(H,27,29)(H,28,30)/b26-13+ |
| InChIKey | HHWUGRIDDYDYKU-LGJNPRDNSA-N |
| XLogP | 4.78 |
| TPSA | 89.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.33 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|