C27H24N4O5 — CID 126025869
N-(2-methoxyphenyl)-2-[4-[(Z)-[(2-quinolin-8-yloxyacetyl)hydrazinylidene]methyl]phenoxy]acetamide (PubChem CID 126025869) has the molecular formula C27H24N4O5 and a molecular weight of 484.51 g/mol. Its IUPAC name is N-(2-methoxyphenyl)-2-[4-[(Z)-[(2-quinolin-8-yloxyacetyl)hydrazinylidene]methyl]phenoxy]acetamide.
| Compound Name | N-(2-methoxyphenyl)-2-[4-[(Z)-[(2-quinolin-8-yloxyacetyl)hydrazinylidene]methyl]phenoxy]acetamide |
|---|---|
| PubChem CID | 126025869 |
| Molecular Formula | C27H24N4O5 |
| Molecular Weight | 484.51 g/mol |
| Exact Mass | 484.17 |
| IUPAC Name | N-(2-methoxyphenyl)-2-[4-[(Z)-[(2-quinolin-8-yloxyacetyl)hydrazinylidene]methyl]phenoxy]acetamide |
| SMILES | COc1ccccc1NC(=O)COc1ccc(/C=N\NC(=O)COc2cccc3cccnc23)cc1 |
| InChI | InChI=1S/C27H24N4O5/c1-34-23-9-3-2-8-22(23)30-25(32)17-35-21-13-11-19(12-14-21)16-29-31-26(33)18-36-24-10-4-6-20-7-5-15-28-27(20)24/h2-16H,17-18H2,1H3,(H,30,32)(H,31,33)/b29-16- |
| InChIKey | IOBXXOVNYYRXKM-MWLSYYOVSA-N |
| XLogP | 3.79 |
| TPSA | 111.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.51 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|