C22H21N3O6 — CID 41271108
(2R)-2-[2-methoxy-4-[(Z)-[(2-quinolin-8-yloxyacetyl)hydrazinylidene]methyl]phenoxy]propanoic acid (PubChem CID 41271108) has the molecular formula C22H21N3O6 and a molecular weight of 423.43 g/mol. Its IUPAC name is (2R)-2-[2-methoxy-4-[(Z)-[(2-quinolin-8-yloxyacetyl)hydrazinylidene]methyl]phenoxy]propanoic acid.
| Compound Name | (2R)-2-[2-methoxy-4-[(Z)-[(2-quinolin-8-yloxyacetyl)hydrazinylidene]methyl]phenoxy]propanoic acid |
|---|---|
| PubChem CID | 41271108 |
| Molecular Formula | C22H21N3O6 |
| Molecular Weight | 423.43 g/mol |
| Exact Mass | 423.14 |
| IUPAC Name | (2R)-2-[2-methoxy-4-[(Z)-[(2-quinolin-8-yloxyacetyl)hydrazinylidene]methyl]phenoxy]propanoic acid |
| SMILES | COc1cc(/C=N\NC(=O)COc2cccc3cccnc23)ccc1O[C@H](C)C(=O)O |
| InChI | InChI=1S/C22H21N3O6/c1-14(22(27)28)31-17-9-8-15(11-19(17)29-2)12-24-25-20(26)13-30-18-7-3-5-16-6-4-10-23-21(16)18/h3-12,14H,13H2,1-2H3,(H,25,26)(H,27,28)/b24-12-/t14-/m1/s1 |
| InChIKey | MORQMGCVCQWUSZ-KPQXCZDLSA-N |
| XLogP | 2.62 |
| TPSA | 119.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.43 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|