C20H19N3O5 — CID 137063536
N-[(Z)-(4-hydroxy-3,5-dimethoxyphenyl)methylideneamino]-2-quinolin-8-yloxyacetamide (PubChem CID 137063536) has the molecular formula C20H19N3O5 and a molecular weight of 381.39 g/mol. Its IUPAC name is N-[(Z)-(4-hydroxy-3,5-dimethoxyphenyl)methylideneamino]-2-quinolin-8-yloxyacetamide.
| Compound Name | N-[(Z)-(4-hydroxy-3,5-dimethoxyphenyl)methylideneamino]-2-quinolin-8-yloxyacetamide |
|---|---|
| PubChem CID | 137063536 |
| Molecular Formula | C20H19N3O5 |
| Molecular Weight | 381.39 g/mol |
| Exact Mass | 381.13 |
| IUPAC Name | N-[(Z)-(4-hydroxy-3,5-dimethoxyphenyl)methylideneamino]-2-quinolin-8-yloxyacetamide |
| SMILES | COc1cc(/C=N\NC(=O)COc2cccc3cccnc23)cc(OC)c1O |
| InChI | InChI=1S/C20H19N3O5/c1-26-16-9-13(10-17(27-2)20(16)25)11-22-23-18(24)12-28-15-7-3-5-14-6-4-8-21-19(14)15/h3-11,25H,12H2,1-2H3,(H,23,24)/b22-11- |
| InChIKey | BJEFTVPNRYTAQH-JJFYIABZSA-N |
| XLogP | 2.49 |
| TPSA | 102.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.39 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hzone_phenol_B(215)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|