C20H18N4O6 — CID 137047432
N-[(E)-(3-ethoxy-4-hydroxy-5-nitrophenyl)methylideneamino]-2-quinolin-8-yloxyacetamide (PubChem CID 137047432) has the molecular formula C20H18N4O6 and a molecular weight of 410.39 g/mol. Its IUPAC name is N-[(E)-(3-ethoxy-4-hydroxy-5-nitrophenyl)methylideneamino]-2-quinolin-8-yloxyacetamide.
| Compound Name | N-[(E)-(3-ethoxy-4-hydroxy-5-nitrophenyl)methylideneamino]-2-quinolin-8-yloxyacetamide |
|---|---|
| PubChem CID | 137047432 |
| Molecular Formula | C20H18N4O6 |
| Molecular Weight | 410.39 g/mol |
| Exact Mass | 410.12 |
| IUPAC Name | N-[(E)-(3-ethoxy-4-hydroxy-5-nitrophenyl)methylideneamino]-2-quinolin-8-yloxyacetamide |
| SMILES | CCOc1cc(/C=N/NC(=O)COc2cccc3cccnc23)cc([N+](=O)[O-])c1O |
| InChI | InChI=1S/C20H18N4O6/c1-2-29-17-10-13(9-15(20(17)26)24(27)28)11-22-23-18(25)12-30-16-7-3-5-14-6-4-8-21-19(14)16/h3-11,26H,2,12H2,1H3,(H,23,25)/b22-11+ |
| InChIKey | TZTQZKNQAQFXEW-SSDVNMTOSA-N |
| XLogP | 2.78 |
| TPSA | 136.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.39 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hzone_phenol_B(215)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|